Mission and Overview
NVD is the U.S. government repository of standards based vulnerability management data. This data enables automation of vulnerability management, security measurement, and compliance (e.g. FISMA).
Resource Status
NVD contains:

Last updated: 9/1/2014 3:09:58 PM

CVE Publication rate: 13.23

Email List

NVD provides four mailing lists to the public. For information and subscription instructions please visit NVD Mailing Lists

Workload Index
Vulnerability Workload Index: 5.82
About Us
NVD is a product of the NIST Computer Security Division and is sponsored by the Department of Homeland Security's National Cyber Security Division. It supports the U.S. government multi-agency (OSD, DHS, NSA, DISA, and NIST) Information Security Automation Program. It is the U.S. government content repository for the Security Content Automation Protocol (SCAP).

National Cyber Awareness System

Vulnerability Summary for CVE-2011-3303

Original release date: 10/06/2011
Last revised: 10/20/2011


Cisco Adaptive Security Appliances (ASA) 5500 series devices, and the ASA Services module in Cisco Catalyst 6500 series devices, with software 7.0 before 7.0(8.13), 7.1 and 7.2 before 7.2(5.4), 8.0 before 8.0(5.25), 8.1 before 8.1(2.50), 8.2 before 8.2(5.6), 8.3 before 8.3(2.23), 8.4 before 8.4(2.7), and 8.5 before 8.5(1.1) and Cisco Firewall Services Module (aka FWSM) 3.1 before 3.1(21), 3.2 before 3.2(22), 4.0 before 4.0(16), and 4.1 before 4.1(7) allow remote attackers to cause a denial of service (device reload) via malformed ILS traffic, aka Bug IDs CSCtq57697 and CSCtq57802.


CVSS Severity (version 2.0):
CVSS v2 Base Score: 7.8 (HIGH) (AV:N/AC:L/Au:N/C:N/I:N/A:C) (legend)
Impact Subscore: 6.9
Exploitability Subscore: 10.0
CVSS Version 2 Metrics:
Access Vector: Network exploitable
Access Complexity: Low
Authentication: Not required to exploit
Impact Type: Allows disruption of service

References to Advisories, Solutions, and Tools

By selecting these links, you will be leaving NIST webspace. We have provided these links to other web sites because they may have information that would be of interest to you. No inferences should be drawn on account of other sites being referenced, or not, from this page. There may be other web sites that are more appropriate for your purpose. NIST does not necessarily endorse the views expressed, or concur with the facts presented on these sites. Further, NIST does not endorse any commercial products that may be mentioned on these sites. Please address comments about this page to nvd@nist.gov.

External Source: CISCO
Name: 20111005 Multiple Vulnerabilities in Cisco Firewall Services Module
Type: Advisory
External Source: CISCO
Name: 20111005 Multiple Vulnerabilities in Cisco ASA 5500 Series Adaptive Security Appliances and Cisco Catalyst 6500 Series ASA Services Module
Type: Advisory
External Source: XF
Name: cisco-fwsm-ils-dos(70329)
External Source: OSVDB
Name: 76090

Vulnerable software and versions

Skip Navigation Links.
Collapse Configuration 1Configuration 1
Collapse ANDAND
Collapse OROR
* cpe:/a:cisco:adaptive_security_appliance_software:7.2.1
* cpe:/a:cisco:adaptive_security_appliance_software:8.0
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.8%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.5%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.48%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.19%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.18%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.0.5
* cpe:/a:cisco:adaptive_security_appliance_software:8.0.4
* cpe:/a:cisco:adaptive_security_appliance_software:8.0.3
* cpe:/a:cisco:adaptive_security_appliance_software:8.0.2
* cpe:/a:cisco:adaptive_security_appliance_software:7.2.5
* cpe:/a:cisco:adaptive_security_appliance_software:7.2.4
* cpe:/a:cisco:adaptive_security_appliance_software:7.2.3
* cpe:/a:cisco:adaptive_security_appliance_software:7.2.2
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.1
* cpe:/a:cisco:adaptive_security_appliance_software:8.2.1
* cpe:/a:cisco:adaptive_security_appliance_software:8.2.2
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.7
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.8
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.5
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.6
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.2
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.4
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%280%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%285%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%286.7%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%285.2%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%284%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2
* cpe:/a:cisco:adaptive_security_appliance_software:7.1
* cpe:/a:cisco:adaptive_security_appliance_software:
* cpe:/a:cisco:adaptive_security_appliance_software:
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.14%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.15%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.16%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.17%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%281.22%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.10%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0.8:interim
* cpe:/a:cisco:adaptive_security_appliance_software:8.2.2:interim
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%282.7%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%283%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%283.9%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%284%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%286%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%287%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.0%288%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.3%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%283%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%284%29
* cpe:/a:cisco:adaptive_security_appliance_software:7.2%285%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.0%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.0%283%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.0%284%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.1
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%284.1%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%284.4%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.4%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.4%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.4%281.11%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.5%281%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.5
* cpe:/a:cisco:adaptive_security_appliance_software:8.3%282%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.2%285%29
* cpe:/a:cisco:adaptive_security_appliance_software:8.0%285%29
Collapse OROR
* cpe:/h:cisco:5500_series_adaptive_security_appliance
* cpe:/h:cisco:asa_5500
Collapse Configuration 2Configuration 2
Collapse ANDAND
Collapse OROR
* cpe:/a:cisco:firewall_services_module_software:3.1
* cpe:/a:cisco:firewall_services_module_software:3.1%2816%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2817%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2818%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2819%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2820%29
* cpe:/a:cisco:firewall_services_module_software:3.1%285%29
* cpe:/a:cisco:firewall_services_module_software:3.1%286%29
* cpe:/a:cisco:firewall_services_module_software:3.2
* cpe:/a:cisco:firewall_services_module_software:3.2%281%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2813%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2814%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2816%29
* cpe:/a:cisco:firewall_services_module_software:3.2%282%29
* cpe:/a:cisco:firewall_services_module_software:3.2%283%29
* cpe:/a:cisco:firewall_services_module_software:4.0
* cpe:/a:cisco:firewall_services_module_software:4.0%2810%29
* cpe:/a:cisco:firewall_services_module_software:4.0%2811%29
* cpe:/a:cisco:firewall_services_module_software:4.0%2812%29
* cpe:/a:cisco:firewall_services_module_software:4.0%2813%29
* cpe:/a:cisco:firewall_services_module_software:4.0%2814%29
* cpe:/a:cisco:firewall_services_module_software:4.0%284%29
* cpe:/a:cisco:firewall_services_module_software:4.0%286%29
* cpe:/a:cisco:firewall_services_module_software:4.0%287%29
* cpe:/a:cisco:firewall_services_module_software:4.0%288%29
* cpe:/a:cisco:firewall_services_module_software:4.1
* cpe:/a:cisco:firewall_services_module_software:4.1%281%29
* cpe:/a:cisco:firewall_services_module_software:4.1%282%29
* cpe:/a:cisco:firewall_services_module_software:4.1%283%29
* cpe:/a:cisco:firewall_services_module_software:4.1%284%29
* cpe:/a:cisco:firewall_services_module_software:3.1%282%29
* cpe:/a:cisco:firewall_services_module_software:3.1%283%29
* cpe:/a:cisco:firewall_services_module_software:3.1%284%29
* cpe:/a:cisco:firewall_services_module_software:3.1%287%29
* cpe:/a:cisco:firewall_services_module_software:3.1%288%29
* cpe:/a:cisco:firewall_services_module_software:3.1%289%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2810%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2811%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2812%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2813%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2814%29
* cpe:/a:cisco:firewall_services_module_software:3.1%2815%29
* cpe:/a:cisco:firewall_services_module_software:3.2%284%29
* cpe:/a:cisco:firewall_services_module_software:3.2%285%29
* cpe:/a:cisco:firewall_services_module_software:3.2%286%29
* cpe:/a:cisco:firewall_services_module_software:3.2%287%29
* cpe:/a:cisco:firewall_services_module_software:3.2%288%29
* cpe:/a:cisco:firewall_services_module_software:3.2%289%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2810%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2811%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2812%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2815%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2817%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2818%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2819%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2820%29
* cpe:/a:cisco:firewall_services_module_software:3.2%2821%29
* cpe:/a:cisco:firewall_services_module_software:4.0%281%29
* cpe:/a:cisco:firewall_services_module_software:4.0%282%29
* cpe:/a:cisco:firewall_services_module_software:4.0%283%29
* cpe:/a:cisco:firewall_services_module_software:4.0%285%29
* cpe:/a:cisco:firewall_services_module_software:4.0%2815%29
* cpe:/a:cisco:firewall_services_module_software:4.1%285%29
* cpe:/a:cisco:firewall_services_module_software:4.1%286%29
Collapse OROR
* cpe:/h:cisco:catalyst_7600
* cpe:/h:cisco:catalyst_6500
* Denotes Vulnerable Software
Changes related to vulnerability configurations

Technical Details

Vulnerability Type (View All)
  • Resource Management Errors (CWE-399)